Organic acids and derivatives
Filtered Search Results
Dehydroacetic acid, 98%
CAS: 520-45-6 Molecular Formula: C8H8O4 Molecular Weight (g/mol): 168.15 MDL Number: MFCD00066709 InChI Key: PGRHXDWITVMQBC-UHFFFAOYSA-N Synonym: dehydroacetic acid,3-acetyl-6-methyl-2h-pyran-2,4 3h-dione,methylacetopyronone,dehydracetic acid,biocide 470f,acetic acid, dehydro,3-acetyl-6-methyl-2,4-pyrandione,2h-pyran-2,4 3h-dione, 3-acetyl-6-methyl,3-acetyl-6-methyl-pyran-2,4-dione,3-acetyl-6-methyldihydropyrandione-2,4 PubChem CID: 122903 IUPAC Name: 3-acetyl-6-methylpyran-2,4-dione SMILES: CC1=CC(=O)C(C(=O)O1)C(=O)C
| PubChem CID | 122903 |
|---|---|
| CAS | 520-45-6 |
| Molecular Weight (g/mol) | 168.15 |
| MDL Number | MFCD00066709 |
| SMILES | CC1=CC(=O)C(C(=O)O1)C(=O)C |
| Synonym | dehydroacetic acid,3-acetyl-6-methyl-2h-pyran-2,4 3h-dione,methylacetopyronone,dehydracetic acid,biocide 470f,acetic acid, dehydro,3-acetyl-6-methyl-2,4-pyrandione,2h-pyran-2,4 3h-dione, 3-acetyl-6-methyl,3-acetyl-6-methyl-pyran-2,4-dione,3-acetyl-6-methyldihydropyrandione-2,4 |
| IUPAC Name | 3-acetyl-6-methylpyran-2,4-dione |
| InChI Key | PGRHXDWITVMQBC-UHFFFAOYSA-N |
| Molecular Formula | C8H8O4 |
trans-Methyl crotonate, 96%
CAS: 623-43-8 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00009287 InChI Key: MCVVUJPXSBQTRZ-ONEGZZNKSA-N Synonym: methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester PubChem CID: 638132 SMILES: COC(=O)\C=C\C
| PubChem CID | 638132 |
|---|---|
| CAS | 623-43-8 |
| Molecular Weight (g/mol) | 100.12 |
| MDL Number | MFCD00009287 |
| SMILES | COC(=O)\C=C\C |
| Synonym | methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester |
| InChI Key | MCVVUJPXSBQTRZ-ONEGZZNKSA-N |
| Molecular Formula | C5H8O2 |
Methyle3,4-diaminobenzoate, 97%, Thermo Scientific™
CAS: 36692-49-6 Molecular Formula: C8H10N2O2 Molecular Weight (g/mol): 166.18 MDL Number: MFCD00017098 InChI Key: IOPLHGOSNCJOOO-UHFFFAOYSA-N Synonym: 3,4-diaminobenzoic acid methyl ester,methyl3,4-diaminobenzoate,methyl-3,4-diaminobenzoate,benzoic acid, 3,4-diamino-, methyl ester,3,4-diamino-benzoic acid methyl ester,methyl 3,4-diaminobenzenecarboxylate,pubchem4610,acmc-1bn7s,methyl 3,4-diamino-benzoate,methyl-3,4-diamino-benzoate PubChem CID: 135524 IUPAC Name: methyl 3,4-diaminobenzoate SMILES: COC(=O)C1=CC=C(N)C(N)=C1
| PubChem CID | 135524 |
|---|---|
| CAS | 36692-49-6 |
| Molecular Weight (g/mol) | 166.18 |
| MDL Number | MFCD00017098 |
| SMILES | COC(=O)C1=CC=C(N)C(N)=C1 |
| Synonym | 3,4-diaminobenzoic acid methyl ester,methyl3,4-diaminobenzoate,methyl-3,4-diaminobenzoate,benzoic acid, 3,4-diamino-, methyl ester,3,4-diamino-benzoic acid methyl ester,methyl 3,4-diaminobenzenecarboxylate,pubchem4610,acmc-1bn7s,methyl 3,4-diamino-benzoate,methyl-3,4-diamino-benzoate |
| IUPAC Name | methyl 3,4-diaminobenzoate |
| InChI Key | IOPLHGOSNCJOOO-UHFFFAOYSA-N |
| Molecular Formula | C8H10N2O2 |
Ethyl phenylpropiolate, 98%
CAS: 2216-94-6 Molecular Formula: C11H10O2 Molecular Weight (g/mol): 174.2 MDL Number: MFCD00009185 InChI Key: ACJOYTKWHPEIHW-UHFFFAOYSA-N Synonym: ethyl phenylpropiolate,ethylphenylpropiolate,ethyl 3-phenylpropiolate,ethyl phenylpropriolate,2-propynoic acid, 3-phenyl-, ethyl ester,ethyl 3-phenylpropynoate,ethyl phenylpropynoate,ethyl phenylacetylenecarboxylate,phenylpropiolic acid ethyl ester,ethyl 3-phenyl-2-propynoate PubChem CID: 91516 IUPAC Name: ethyl 3-phenylprop-2-ynoate SMILES: CCOC(=O)C#CC1=CC=CC=C1
| PubChem CID | 91516 |
|---|---|
| CAS | 2216-94-6 |
| Molecular Weight (g/mol) | 174.2 |
| MDL Number | MFCD00009185 |
| SMILES | CCOC(=O)C#CC1=CC=CC=C1 |
| Synonym | ethyl phenylpropiolate,ethylphenylpropiolate,ethyl 3-phenylpropiolate,ethyl phenylpropriolate,2-propynoic acid, 3-phenyl-, ethyl ester,ethyl 3-phenylpropynoate,ethyl phenylpropynoate,ethyl phenylacetylenecarboxylate,phenylpropiolic acid ethyl ester,ethyl 3-phenyl-2-propynoate |
| IUPAC Name | ethyl 3-phenylprop-2-ynoate |
| InChI Key | ACJOYTKWHPEIHW-UHFFFAOYSA-N |
| Molecular Formula | C11H10O2 |
Methyl glycolate, 98%
CAS: 96-35-5 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.08 InChI Key: GSJFXBNYJCXDGI-UHFFFAOYSA-N Synonym: methyl glycolate,methyl hydroxyacetate,acetic acid, hydroxy-, methyl ester,glycolic acid, methyl ester,acetic acid, 2-hydroxy-, methyl ester,glycolic acid methyl ester,unii-7g7r729ej0,hydroxyacetic acid methyl ester,glycolic acid methyl,methyl2-hydroxyethanoate PubChem CID: 66774 IUPAC Name: methyl 2-hydroxyacetate SMILES: COC(=O)CO
| PubChem CID | 66774 |
|---|---|
| CAS | 96-35-5 |
| Molecular Weight (g/mol) | 90.08 |
| SMILES | COC(=O)CO |
| Synonym | methyl glycolate,methyl hydroxyacetate,acetic acid, hydroxy-, methyl ester,glycolic acid, methyl ester,acetic acid, 2-hydroxy-, methyl ester,glycolic acid methyl ester,unii-7g7r729ej0,hydroxyacetic acid methyl ester,glycolic acid methyl,methyl2-hydroxyethanoate |
| IUPAC Name | methyl 2-hydroxyacetate |
| InChI Key | GSJFXBNYJCXDGI-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
Methyl 4-chlorocinnamate, 99%
CAS: 7560-44-3 Molecular Formula: C10H9ClO2 Molecular Weight (g/mol): 196.63 MDL Number: MFCD00075790 InChI Key: IIBXQGYKZKOORG-QPJJXVBHSA-N Synonym: methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate PubChem CID: 5314314 IUPAC Name: methyl (E)-3-(4-chlorophenyl)prop-2-enoate SMILES: COC(=O)C=CC1=CC=C(C=C1)Cl
| PubChem CID | 5314314 |
|---|---|
| CAS | 7560-44-3 |
| Molecular Weight (g/mol) | 196.63 |
| MDL Number | MFCD00075790 |
| SMILES | COC(=O)C=CC1=CC=C(C=C1)Cl |
| Synonym | methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate |
| IUPAC Name | methyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChI Key | IIBXQGYKZKOORG-QPJJXVBHSA-N |
| Molecular Formula | C10H9ClO2 |
Ethyl cyclohexylideneacetate, 98%
CAS: 1552-92-7 Molecular Formula: C10H16O2 Molecular Weight (g/mol): 168.24 MDL Number: MFCD00017627,MFCD00963857 InChI Key: MCWDXHYYYNGYGK-UHFFFAOYSA-N Synonym: ethyl cyclohexylideneacetate,acetic acid, cyclohexylidene-, ethyl ester,ethyl 2-cyclohexylidenacetate,cyclohexylideneacetic acid ethyl ester,ethoxycarbonylmethylenecyclohexane,.delta.1,.alpha.-cyclohexaneacetic acid, ethyl ester,acmc-20ahxr,ethylcyclohexylidenacetate,.delta.1, ethyl ester,ethyl2-cyclohexylideneacetate PubChem CID: 73776 IUPAC Name: ethyl 2-cyclohexylideneacetate SMILES: CCOC(=O)C=C1CCCCC1
| PubChem CID | 73776 |
|---|---|
| CAS | 1552-92-7 |
| Molecular Weight (g/mol) | 168.24 |
| MDL Number | MFCD00017627,MFCD00963857 |
| SMILES | CCOC(=O)C=C1CCCCC1 |
| Synonym | ethyl cyclohexylideneacetate,acetic acid, cyclohexylidene-, ethyl ester,ethyl 2-cyclohexylidenacetate,cyclohexylideneacetic acid ethyl ester,ethoxycarbonylmethylenecyclohexane,.delta.1,.alpha.-cyclohexaneacetic acid, ethyl ester,acmc-20ahxr,ethylcyclohexylidenacetate,.delta.1, ethyl ester,ethyl2-cyclohexylideneacetate |
| IUPAC Name | ethyl 2-cyclohexylideneacetate |
| InChI Key | MCWDXHYYYNGYGK-UHFFFAOYSA-N |
| Molecular Formula | C10H16O2 |
Sodium trifluoromethanesulfonate, 98%
CAS: 2926-30-9 Molecular Formula: CF3NaO3S Molecular Weight (g/mol): 172.05 MDL Number: MFCD00061607 InChI Key: XGPOMXSYOKFBHS-UHFFFAOYSA-M Synonym: sodium trifluoromethanesulfonate,sodium triflate,trifluoromethanesulfonic acid sodium salt,sodium trifluoro methane sulfonate,methanesulfonic acid, trifluoro-, sodium salt,pubchem23598,cf3so3na,acmc-1cfau,sodiumtrifluoromethanesulfonate,ksc491a1d PubChem CID: 23676748 IUPAC Name: sodium;trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].[Na+]
| PubChem CID | 23676748 |
|---|---|
| CAS | 2926-30-9 |
| Molecular Weight (g/mol) | 172.05 |
| MDL Number | MFCD00061607 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].[Na+] |
| Synonym | sodium trifluoromethanesulfonate,sodium triflate,trifluoromethanesulfonic acid sodium salt,sodium trifluoro methane sulfonate,methanesulfonic acid, trifluoro-, sodium salt,pubchem23598,cf3so3na,acmc-1cfau,sodiumtrifluoromethanesulfonate,ksc491a1d |
| IUPAC Name | sodium;trifluoromethanesulfonate |
| InChI Key | XGPOMXSYOKFBHS-UHFFFAOYSA-M |
| Molecular Formula | CF3NaO3S |
Trifluoromethanesulfonamide, 96%
CAS: 421-85-2 Molecular Formula: CH2F3NO2S Molecular Weight (g/mol): 149.09 MDL Number: MFCD00068714 InChI Key: KAKQVSNHTBLJCH-UHFFFAOYSA-N Synonym: trifluoromethanesulphonamide,trifluoromethane sulfonamide,trifluoromethylsulfonamide,1,1,1-trifluoromethanesulfonamide,chembl67511,methanesulfonamide, 1,1,1-trifluoro,1bcd,trifluoromethyl sulfonamide,triflamide,trifluorometanesulfonamide PubChem CID: 79001 IUPAC Name: trifluoromethanesulfonamide SMILES: NS(=O)(=O)C(F)(F)F
| PubChem CID | 79001 |
|---|---|
| CAS | 421-85-2 |
| Molecular Weight (g/mol) | 149.09 |
| MDL Number | MFCD00068714 |
| SMILES | NS(=O)(=O)C(F)(F)F |
| Synonym | trifluoromethanesulphonamide,trifluoromethane sulfonamide,trifluoromethylsulfonamide,1,1,1-trifluoromethanesulfonamide,chembl67511,methanesulfonamide, 1,1,1-trifluoro,1bcd,trifluoromethyl sulfonamide,triflamide,trifluorometanesulfonamide |
| IUPAC Name | trifluoromethanesulfonamide |
| InChI Key | KAKQVSNHTBLJCH-UHFFFAOYSA-N |
| Molecular Formula | CH2F3NO2S |
Methyl benzenesulfonate, 99%
CAS: 80-18-2 Molecular Formula: C7H8O3S Molecular Weight (g/mol): 172.20 MDL Number: MFCD00014737 InChI Key: CZXGXYBOQYQXQD-UHFFFAOYSA-N Synonym: benzenesulfonic acid, methyl ester,methyl benzenesulphonate,methyl besylate,methylbenzenesulfonate,ccris 9156,benzenesulfonic acid methyl ester,methyl benzene sulfonate,methyl ester of benzenesulphonic acid,methylbenzene sulfonate,pubchem22730 PubChem CID: 6630 IUPAC Name: methyl benzenesulfonate SMILES: COS(=O)(=O)C1=CC=CC=C1
| PubChem CID | 6630 |
|---|---|
| CAS | 80-18-2 |
| Molecular Weight (g/mol) | 172.20 |
| MDL Number | MFCD00014737 |
| SMILES | COS(=O)(=O)C1=CC=CC=C1 |
| Synonym | benzenesulfonic acid, methyl ester,methyl benzenesulphonate,methyl besylate,methylbenzenesulfonate,ccris 9156,benzenesulfonic acid methyl ester,methyl benzene sulfonate,methyl ester of benzenesulphonic acid,methylbenzene sulfonate,pubchem22730 |
| IUPAC Name | methyl benzenesulfonate |
| InChI Key | CZXGXYBOQYQXQD-UHFFFAOYSA-N |
| Molecular Formula | C7H8O3S |
LiChropur™ Sodium 1-pentanesulfonate monohydrate , ≥99.0% (T), MilliporeSigma™ Supelco™
MDL Number: MFCD00149548 Synonym: 1-Pentanesulfonic acid sodium salt
| MDL Number | MFCD00149548 |
|---|---|
| Synonym | 1-Pentanesulfonic acid sodium salt |
Taurine, 98.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 107-35-7
| CAS | 107-35-7 |
|---|
Pyridinium trifluoromethanesulfonate, 97%
CAS: 52193-54-1 MDL Number: MFCD00274656 Synonym: pyridinium trifluoromethanesulfonate,pyridinium triflate,pyridin-1-ium trifluoromethanesulfonate,pyridium triflate,acmc-209ky5,pyridinium trifluoromethanesulphonate,pyridin-1-ium; trifluoromethanesulfonate
| CAS | 52193-54-1 |
|---|---|
| MDL Number | MFCD00274656 |
| Synonym | pyridinium trifluoromethanesulfonate,pyridinium triflate,pyridin-1-ium trifluoromethanesulfonate,pyridium triflate,acmc-209ky5,pyridinium trifluoromethanesulphonate,pyridin-1-ium; trifluoromethanesulfonate |
4-Nitrophenyl trifluoromethanesulfonate, 99%, Thermo Scientific™
CAS: 17763-80-3 Molecular Formula: C7H4F3NO5S Molecular Weight (g/mol): 271.17 MDL Number: MFCD00192354 InChI Key: NDTIXHNCNLKURN-UHFFFAOYSA-N Synonym: trifluoromethanesulfonic acid 4-nitrophenyl ester,4-nitrophenyltriflate,4-nitrophenyl triflate,acmc-20amc8,4-nitrophenyl trifluoromethyl sulfonate,4-nitrophenyl trifluoromethanesulfonate,1-trifluoromethylsulfonyloxy-4-nitrobenzene,4-trifluoromethylsulfonyloxy-1-nitrobenzene PubChem CID: 549870 IUPAC Name: (4-nitrophenyl) trifluoromethanesulfonate SMILES: [O-][N+](=O)C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1
| PubChem CID | 549870 |
|---|---|
| CAS | 17763-80-3 |
| Molecular Weight (g/mol) | 271.17 |
| MDL Number | MFCD00192354 |
| SMILES | [O-][N+](=O)C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1 |
| Synonym | trifluoromethanesulfonic acid 4-nitrophenyl ester,4-nitrophenyltriflate,4-nitrophenyl triflate,acmc-20amc8,4-nitrophenyl trifluoromethyl sulfonate,4-nitrophenyl trifluoromethanesulfonate,1-trifluoromethylsulfonyloxy-4-nitrobenzene,4-trifluoromethylsulfonyloxy-1-nitrobenzene |
| IUPAC Name | (4-nitrophenyl) trifluoromethanesulfonate |
| InChI Key | NDTIXHNCNLKURN-UHFFFAOYSA-N |
| Molecular Formula | C7H4F3NO5S |
Benzenesulfonic acid, sodium salt, 98%
CAS: 515-42-4 Molecular Formula: C6H5NaO3S Molecular Weight (g/mol): 180.16 MDL Number: MFCD00065179 InChI Key: MZSDGDXXBZSFTG-UHFFFAOYSA-M Synonym: sodium benzenesulfonate,benzenesulfonic acid sodium salt,benzenesulfonic acid, sodium salt,dispersant gn,sodium phenylsulfonate,sodium benzenesulphonate,sodium benzene sulfonate,sodium benzene monosulfate,unii-k5rm14azhx,sodium benzene monosulfonate PubChem CID: 517327 IUPAC Name: sodium;benzenesulfonate SMILES: C1=CC=C(C=C1)S(=O)(=O)[O-].[Na+]
| PubChem CID | 517327 |
|---|---|
| CAS | 515-42-4 |
| Molecular Weight (g/mol) | 180.16 |
| MDL Number | MFCD00065179 |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)[O-].[Na+] |
| Synonym | sodium benzenesulfonate,benzenesulfonic acid sodium salt,benzenesulfonic acid, sodium salt,dispersant gn,sodium phenylsulfonate,sodium benzenesulphonate,sodium benzene sulfonate,sodium benzene monosulfate,unii-k5rm14azhx,sodium benzene monosulfonate |
| IUPAC Name | sodium;benzenesulfonate |
| InChI Key | MZSDGDXXBZSFTG-UHFFFAOYSA-M |
| Molecular Formula | C6H5NaO3S |